EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O2 |
| Net Charge | 0 |
| Average Mass | 332.403 |
| Monoisotopic Mass | 332.15248 |
| SMILES | CCOC(=O)C(C)(c1cnc2ccccc12)c1cnc2ccccc12 |
| InChI | InChI=1S/C21H20N2O2/c1-3-25-20(24)21(2,16-12-22-18-10-6-4-8-14(16)18)17-13-23-19-11-7-5-9-15(17)19/h4-13,22-23H,3H2,1-2H3 |
| InChIKey | JJYXPVIOPCTYAP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 2,2-di(1H-indol-3-yl)propanoate (CHEBI:188761) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| ethyl 2,2-bis(1H-indol-3-yl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| 234771 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:70837-47-7 | ChemIDplus |