EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25ClFN7O |
| Net Charge | 0 |
| Average Mass | 469.952 |
| Monoisotopic Mass | 469.17931 |
| SMILES | Cc1cc(Nc2cc(CN3CCOCC3)c3nc(C)c(Cc4ccc(Cl)cc4F)n3n2)nn1 |
| InChI | InChI=1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | SQSZANZGUXWJEA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gandotinib (CHEBI:188757) has role antineoplastic agent (CHEBI:35610) |
| Gandotinib (CHEBI:188757) is a organic molecular entity (CHEBI:50860) |
| Gandotinib (CHEBI:188757) is a organofluorine compound (CHEBI:37143) |
| Gandotinib (CHEBI:188757) is a pyridazines (CHEBI:37921) |
| IUPAC Name |
|---|
| 3-[(4-chloro-2-luorophenyl)methyl]-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)-8-(morpholin-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| INN | Source |
|---|---|
| gandotinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-2784544 | ChEMBL |
| LY2784544 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1229236-86-5 | ChemIDplus |
| Citations |
|---|