EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3S |
| Net Charge | 0 |
| Average Mass | 164.226 |
| Monoisotopic Mass | 164.05072 |
| SMILES | C[S+](C)CCC(O)C(=O)[O-] |
| InChI | InChI=1S/C6H12O3S/c1-10(2)4-3-5(7)6(8)9/h5,7H,3-4H2,1-2H3 |
| InChIKey | BEBZGOSIJCIAKQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(Dimethylsulfonio)-2-hydroxybutanoate (CHEBI:188733) is a thia fatty acid (CHEBI:59643) |
| IUPAC Name |
|---|
| 4-dimethylsulonio-2-hydroxybutanoate |
| Manual Xrefs | Databases |
|---|---|
| 11485872 | ChemSpider |