EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O5 |
| Net Charge | 0 |
| Average Mass | 440.540 |
| Monoisotopic Mass | 440.23112 |
| SMILES | [H][C@]12CC[C@]([H])(O1)[C@H](Cc1ccccc1CCC(=O)O)[C@]2([H])c1nc(C(=O)NCCCCC)co1 |
| InChI | InChI=1S/C25H32N2O5/c1-2-3-6-13-26-24(30)19-15-31-25(27-19)23-18(20-10-11-21(23)32-20)14-17-8-5-4-7-16(17)9-12-22(28)29/h4-5,7-8,15,18,20-21,23H,2-3,6,9-14H2,1H3,(H,26,30)(H,28,29)/t18-,20-,21+,23-/m0/s1 |
| InChIKey | BBPRUNPUJIUXSE-DXKRWKNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ifetroban (CHEBI:188730) is a benzenes (CHEBI:22712) |
| ifetroban (CHEBI:188730) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[2-[[(1S,2R,3S,4R)-3-[4-(pentylcarbamoyl)-1,3-oxazol-2-yl]-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]phenyl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:143443-90-7 | ChemIDplus |