EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25ClO7 |
| Net Charge | 0 |
| Average Mass | 436.888 |
| Monoisotopic Mass | 436.12888 |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H25ClO7/c1-2-28-16-6-3-13(4-7-16)9-14-10-15(5-8-17(14)23)22-20(27)18(25)19(26)21(11-24,30-22)12-29-22/h3-8,10,18-20,24-27H,2,9,11-12H2,1H3/t18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | MCIACXAZCBVDEE-CUUWFGFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ertugliflozin (CHEBI:188719) has role cardiovascular drug (CHEBI:35554) |
| Ertugliflozin (CHEBI:188719) has role hypoglycemic agent (CHEBI:35526) |
| Ertugliflozin (CHEBI:188719) is a diarylmethane (CHEBI:51614) |
| IUPAC Name |
|---|
| (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| INNs | Source |
|---|---|
| ertugliflozina | WHO MedNet |
| ertugliflozine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ertugliflozin | ChEMBL |
| MK-8835 | ChEMBL |
| Pf-04971729 | ChEMBL |
| PF04971729 | ChEMBL |
| PF-04971729-00 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1210344-57-2 | ChemIDplus |
| Citations |
|---|