EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H24N4O2 |
| Net Charge | 0 |
| Average Mass | 448.526 |
| Monoisotopic Mass | 448.18993 |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2cc3cccc4c3n2CCC4)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H24N4O2/c1-31-22-15-6-5-14-21(22)24(18-9-3-2-4-10-18)29-26(28(31)34)30-27(33)23-17-20-12-7-11-19-13-8-16-32(23)25(19)20/h2-7,9-12,14-15,17,26H,8,13,16H2,1H3,(H,30,33)/t26-/m1/s1 |
| InChIKey | CZPILLBHPRAPCB-AREMUKBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tarazepide (CHEBI:188716) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxamide |
| Registry Numbers | Sources |
|---|---|
| CAS:141374-81-4 | ChemIDplus |