EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25O2P |
| Net Charge | 0 |
| Average Mass | 376.436 |
| Monoisotopic Mass | 376.15922 |
| SMILES | CC(C)(C)OC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25O2P/c1-24(2,3)26-23(25)19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19H,1-3H3 |
| InChIKey | ZWZUFQPXYVYAFO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tert-butyl (triphenylphosphoranylidene)acetate (CHEBI:188699) is a phosphine (CHEBI:35883) |
| IUPAC Name |
|---|
| tert-butyl 2-(triphenyl-lambda5-phosphanylidene)acetate |
| Manual Xrefs | Databases |
|---|---|
| 224613 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:35000-38-5 | ChemIDplus |