EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N2O4 |
| Net Charge | 0 |
| Average Mass | 320.389 |
| Monoisotopic Mass | 320.17361 |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(2,3)23-16(22)19-11-9-18(10-12-19)14(15(20)21)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,20,21) |
| InChIKey | QPEHPIVVAWESTM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-Boc-piperazino)-2-phenylacetic acid (CHEBI:188667) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-2-phenylacetic acid |
| Manual Xrefs | Databases |
|---|---|
| 2042934 | ChemSpider |