EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24FN5O3 |
| Net Charge | 0 |
| Average Mass | 401.442 |
| Monoisotopic Mass | 401.18632 |
| SMILES | COC(=O)N1CCN(Cc2cccc(NC(=O)Nc3ccc(C)nc3)c2F)CC1 |
| InChI | InChI=1S/C20H24FN5O3/c1-14-6-7-16(12-22-14)23-19(27)24-17-5-3-4-15(18(17)21)13-25-8-10-26(11-9-25)20(28)29-2/h3-7,12H,8-11,13H2,1-2H3,(H2,23,24,27) |
| InChIKey | RFUBTTPMWSKEIW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| omecamtiv mecarbil (CHEBI:188664) has role cardiovascular drug (CHEBI:35554) |
| omecamtiv mecarbil (CHEBI:188664) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| methyl 4-[[2-luoro-3-[(6-methylpyridin-3-yl)carbamoylamino]phenyl]methyl]piperazine-1-carboxylate |
| INN | Source |
|---|---|
| omecamtiv mecarbilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| CK-1827452 | ChEMBL |
| Omecamtiv mecarbil | ChEMBL |
| Citations |
|---|