EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N4O5 |
| Net Charge | 0 |
| Average Mass | 494.592 |
| Monoisotopic Mass | 494.25292 |
| SMILES | [H][C@]1(C2Cc3ccccc3C2)NC(=O)[C@@]([H])([C@@H](C)CC)N([C@@H](C(=O)N2CCOCC2)c2coc(C)n2)C1=O |
| InChI | InChI=1S/C27H34N4O5/c1-4-16(2)23-25(32)29-22(20-13-18-7-5-6-8-19(18)14-20)26(33)31(23)24(21-15-36-17(3)28-21)27(34)30-9-11-35-12-10-30/h5-8,15-16,20,22-24H,4,9-14H2,1-3H3,(H,29,32)/t16-,22+,23+,24+/m0/s1 |
| InChIKey | PLVGDGRBPMVYPB-FDUHJNRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Retosiban (CHEBI:188651) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (3R,6R)-6-[(2S)-butan-2-yl]-3-(2,3-dihydro-1H-inden-2-yl)-1-[(1R)-1-(2-methyl-1,3-oxazol-4-yl)-2-morpholin-4-yl-2-oxoethyl]piperazine-2,5-dione |
| Registry Numbers | Sources |
|---|---|
| CAS:820957-38-8 | ChemIDplus |