EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NOS |
| Net Charge | 0 |
| Average Mass | 261.390 |
| Monoisotopic Mass | 261.11874 |
| SMILES | CN(CCC(O)c1cccs1)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NOS/c1-16(12-13-6-3-2-4-7-13)10-9-14(17)15-8-5-11-18-15/h2-8,11,14,17H,9-10,12H2,1H3 |
| InChIKey | FVFKXJFOAPEKPV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[Benzyl(methyl)amino]-1-(2-thienyl)-1-propanol (CHEBI:188631) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 3-[benzyl(methyl)amino]-1-thiophen-2-ylpropan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 25573163 | ChemSpider |