EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N4O2S |
| Net Charge | 0 |
| Average Mass | 376.441 |
| Monoisotopic Mass | 376.09940 |
| SMILES | CC(=O)N(C)c1cccc(-c2ccnc3c(C(=O)c4cccs4)cnn23)c1 |
| InChI | InChI=1S/C20H16N4O2S/c1-13(25)23(2)15-6-3-5-14(11-15)17-8-9-21-20-16(12-22-24(17)20)19(26)18-7-4-10-27-18/h3-12H,1-2H3 |
| InChIKey | CBIAWPMZSFFRGN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indiplon (CHEBI:188583) has role antidepressant (CHEBI:35469) |
| Indiplon (CHEBI:188583) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| N-methyl-N-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]acetamide |
| INNs | Source |
|---|---|
| indiplon | WHO MedNet |
| indiplone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Calenthys | ChEMBL |
| CL-285489 | ChEMBL |
| NBI-34060 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:325715-02-4 | ChemIDplus |
| Citations |
|---|