EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33ClN4O6 |
| Net Charge | 0 |
| Average Mass | 509.003 |
| Monoisotopic Mass | 508.20886 |
| SMILES | CCO[C@@H]1OC(=O)C[C@@H]1NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C24H33ClN4O6/c1-5-34-23-16(12-18(30)35-23)27-21(32)17-7-6-10-29(17)22(33)19(24(2,3)4)28-20(31)13-8-9-15(26)14(25)11-13/h8-9,11,16-17,19,23H,5-7,10,12,26H2,1-4H3,(H,27,32)(H,28,31)/t16-,17-,19+,23+/m0/s1 |
| InChIKey | SJDDOCKBXFJEJB-MOKWFATOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Belnacasan (CHEBI:188567) has role anticonvulsant (CHEBI:35623) |
| Belnacasan (CHEBI:188567) has role antipsoriatic (CHEBI:50748) |
| Belnacasan (CHEBI:188567) has role antiviral agent (CHEBI:22587) |
| Belnacasan (CHEBI:188567) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]-N-[(2R,3S)-2-ethoxy-5-oxooxolan-3-yl]pyrrolidine-2-carboxamide |
| INNs | Source |
|---|---|
| belcanasan | WHO MedNet |
| belnacasan | WHO MedNet |
| Synonyms | Source |
|---|---|
| VX-765 | ChEMBL |
| VX765 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:273404-37-8 | ChemIDplus |
| Citations |
|---|