EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5S |
| Net Charge | 0 |
| Average Mass | 339.468 |
| Monoisotopic Mass | 339.15177 |
| SMILES | CCc1nn(C2CCCC2)c2c1CCn1c(-c3cccs3)nnc1-2 |
| InChI | InChI=1S/C18H21N5S/c1-2-14-13-9-10-22-17(15-8-5-11-24-15)19-20-18(22)16(13)23(21-14)12-6-3-4-7-12/h5,8,11-12H,2-4,6-7,9-10H2,1H3 |
| InChIKey | DHCOPPHTVOXDKU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tofimilast (CHEBI:188562) has role anti-asthmatic agent (CHEBI:65023) |
| Tofimilast (CHEBI:188562) is a triazolopyridine (CHEBI:46746) |
| IUPAC Name |
|---|
| 12-cyclopentyl-10-ethyl-5-thiophen-2-yl-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene |
| INN | Source |
|---|---|
| tofimilast | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-325,366 | ChEMBL |
| CP-325366 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:185954-27-2 | ChemIDplus |
| Citations |
|---|