EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO7 |
| Net Charge | 0 |
| Average Mass | 365.382 |
| Monoisotopic Mass | 365.14745 |
| SMILES | O=C(CCCc1cnc2ccccc12)OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H23NO7/c20-9-13-15(22)16(23)17(24)18(25-13)26-14(21)7-3-4-10-8-19-12-6-2-1-5-11(10)12/h1-2,5-6,8,13,15-20,22-24H,3-4,7,9H2/t13-,15-,16+,17-,18?/m1/s1 |
| InChIKey | CIJFFKOICMQHCH-SRKZOOFXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-[4-(1H-Indol-3-yl)butanoyl]-D-glucopyranose (CHEBI:188531) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-(1H-indol-3-yl)butanoate |
| Manual Xrefs | Databases |
|---|---|
| 58829758 | ChemSpider |