EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N2 |
| Net Charge | 0 |
| Average Mass | 60.100 |
| Monoisotopic Mass | 60.06875 |
| SMILES | CN(C)N |
| InChI | InChI=1S/C2H8N2/c1-4(2)3/h3H2,1-2H3 |
| InChIKey | RHUYHJGZWVXEHW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Application: | fuel An energy-rich substance that can be transformed with release of usable energy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-dimethylhydrazine (CHEBI:18853) has functional parent hydrazine (CHEBI:15571) |
| 1,1-dimethylhydrazine (CHEBI:18853) has role carcinogenic agent (CHEBI:50903) |
| 1,1-dimethylhydrazine (CHEBI:18853) has role fuel (CHEBI:33292) |
| 1,1-dimethylhydrazine (CHEBI:18853) has role teratogenic agent (CHEBI:50905) |
| 1,1-dimethylhydrazine (CHEBI:18853) is a hydrazines (CHEBI:24631) |
| IUPAC Name |
|---|
| 1,1-dimethylhydrazine |
| Synonyms | Source |
|---|---|
| 1,1-Dimethylhydrazin | ChemIDplus |
| Dimazine | ChemIDplus |
| gem-Dimethylhydrazine | ChemIDplus |
| N,N-Dimethylhydrazine | ChemIDplus |
| unsymmetrical dimethylhydrazine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19233 | KEGG COMPOUND |
| Unsymmetrical_dimethylhydrazine | Wikipedia |
| Citations |
|---|