EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12F2N2O |
| Net Charge | 0 |
| Average Mass | 214.215 |
| Monoisotopic Mass | 214.09177 |
| SMILES | FC(F)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C10H12F2N2O/c11-10(12)8-1-2-9(13-7-8)14-3-5-15-6-4-14/h1-2,7,10H,3-6H2 |
| InChIKey | DTUIJCOXMWDNMU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllostachys violascens (ncbitaxon:1903417) | stem (BTO:0001300) | MetaboLights (MTBLS3970) | Strain: Phyllostachys violascens cv. Viridisulcata |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[5-(Difluoromethyl)-2-pyridinyl]morpholine (CHEBI:188514) is a dialkylarylamine (CHEBI:23665) |
| 4-[5-(Difluoromethyl)-2-pyridinyl]morpholine (CHEBI:188514) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-[5-(diluoromethyl)pyridin-2-yl]morpholine |
| Manual Xrefs | Databases |
|---|---|
| 65326360 | ChemSpider |