EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41NO7 |
| Net Charge | 0 |
| Average Mass | 467.603 |
| Monoisotopic Mass | 467.28830 |
| SMILES | CC(=O)[C@H]1OC(=O)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C25H41NO7/c1-13-9-10-20(28)14(2)11-15(3)22(17(5)24(30)32-23(13)18(6)27)33-25-21(29)19(26(7)8)12-16(4)31-25/h9-10,13-17,19,21-23,25,29H,11-12H2,1-8H3/b10-9+/t13-,14-,15+,16-,17-,19+,21-,22+,23+,25?/m1/s1 |
| InChIKey | QLGGSZVTUJLCIL-DNEDYFHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. AM4900 (ncbitaxon:1931) | - | PubMed (33590846) | Cluster: LC596414 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-ketomethymycin (CHEBI:188461) has functional parent 10-deoxymethymycin (CHEBI:29706) |
| 12-ketomethymycin (CHEBI:188461) has role antineoplastic agent (CHEBI:35610) |
| 12-ketomethymycin (CHEBI:188461) has role bacterial metabolite (CHEBI:76969) |
| 12-ketomethymycin (CHEBI:188461) is a enone (CHEBI:51689) |
| 12-ketomethymycin (CHEBI:188461) is a macrolide (CHEBI:25106) |
| 12-ketomethymycin (CHEBI:188461) is a monosaccharide derivative (CHEBI:63367) |
| Incoming Relation(s) |
| 12-ketomethymycin N-oxide (CHEBI:188462) has functional parent 12-ketomethymycin (CHEBI:188461) |
| IUPAC Name |
|---|
| (3R,4S,5S,7R,9E,11R,12R)-12-acetonyl-3,5,7,11-tetramethyl-2,8-dioxooxacyclododec-9-en-4-yl 3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside |
| Citations |
|---|