EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | CCCCC(NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-2-3-4-6(8(12)13)9-5-7(10)11/h6,9H,2-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | MBBNCIKYWHIZGN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxyhexanoylglycine (CHEBI:188438) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(carboxymethylamino)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849629 | ChemSpider |
| HMDB0094718 | HMDB |