EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | OC1CCCNC1c1ccco1 |
| InChI | InChI=1S/C9H13NO2/c11-7-3-1-5-10-9(7)8-4-2-6-12-8/h2,4,6-7,9-11H,1,3,5H2 |
| InChIKey | KPVVMDIEDRJBAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-Furanyl)-3-piperidinol (CHEBI:188409) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-(uran-2-yl)piperidin-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 27259391 | ChemSpider |
| HMDB0039837 | HMDB |