EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2 |
| Net Charge | 0 |
| Average Mass | 166.220 |
| Monoisotopic Mass | 166.09938 |
| SMILES | C/C=C/C=C/CC/C=C/C(=O)O |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-5,8-9H,6-7H2,1H3,(H,11,12)/b3-2+,5-4+,9-8+ |
| InChIKey | VBYOTISTNZJGRH-DTFLGMRGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2E,6E,8E-decatrienoic acid (CHEBI:188402) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,6E,8E)-deca-2,6,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4471792 | ChemSpider |
| LMFA01030215 | LIPID MAPS |