EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O6S |
| Net Charge | 0 |
| Average Mass | 244.224 |
| Monoisotopic Mass | 244.00416 |
| SMILES | O=C(O)C=Cc1cccc(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H8O6S/c10-9(11)5-4-7-2-1-3-8(6-7)15-16(12,13)14/h1-6H,(H,10,11)(H,12,13,14) |
| InChIKey | YPXHXDXMTWPQTO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[3-(sulfooxy)phenyl]prop-2-enoic acid (CHEBI:188394) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 3-(3-sulooxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74852086 | ChemSpider |
| HMDB0127985 | HMDB |