EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O16 |
| Net Charge | 0 |
| Average Mass | 508.385 |
| Monoisotopic Mass | 508.10643 |
| SMILES | O=C(OC1C(O)C(O)OC(CO)C1O)c1cc(O)c(O)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C19H24O16/c20-3-7-9(23)14(13(27)18(31)32-7)34-17(30)4-1-5(21)8(22)6(2-4)33-19-12(26)10(24)11(25)15(35-19)16(28)29/h1-2,7,9-15,18-27,31H,3H2,(H,28,29) |
| InChIKey | HNANYZDYDZPKDC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[2,3-dihydroxy-5-({[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}carbonyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:188390) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-[2,3-dihydroxy-5-[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxycarbonylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133148 | HMDB |