EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | CCCCCCc1ccc(CCCCCC(=O)O)o1 |
| InChI | InChI=1S/C16H26O3/c1-2-3-4-6-9-14-12-13-15(19-14)10-7-5-8-11-16(17)18/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | HPFDAHYFHAOXSC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | blood serum (BTO:0000133) | MetaboLights (MTBLS3886) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hexyl-2-furanhexanoic acid (CHEBI:188382) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 6-(5-hexyluran-2-yl)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849744 | ChemSpider |
| HMDB0112088 | HMDB |