EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H16Si |
| Net Charge | 0 |
| Average Mass | 116.280 |
| Monoisotopic Mass | 116.10213 |
| SMILES | [H][Si](CC)(CC)CC |
| InChI | InChI=1S/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3 |
| InChIKey | AQRLNPVMDITEJU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triethylsilane (CHEBI:188370) has role reducing agent (CHEBI:63247) |
| triethylsilane (CHEBI:188370) is a organosilicon compound (CHEBI:25713) |
| IUPAC Name |
|---|
| triethylsilane |
| Synonyms | Source |
|---|---|
| Triethylsilan | SUBMITTER |
| triethylsilylhydride | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/Triethylsilane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1098278 | Beilstein |
| CAS:617-86-7 | SUBMITTER |