EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H6N2S |
| Net Charge | 0 |
| Average Mass | 90.151 |
| Monoisotopic Mass | 90.02517 |
| SMILES | CNC(N)=S |
| InChI | InChI=1S/C2H6N2S/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| InChIKey | KQJQICVXLJTWQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylthiourea (CHEBI:188347) has functional parent thiourea (CHEBI:36946) |
| N-methylthiourea (CHEBI:188347) has role drug metabolite (CHEBI:49103) |
| N-methylthiourea (CHEBI:188347) has role hepatotoxic agent (CHEBI:50908) |
| N-methylthiourea (CHEBI:188347) has role human xenobiotic metabolite (CHEBI:76967) |
| N-methylthiourea (CHEBI:188347) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N-methylthiourea |
| Synonyms | Source |
|---|---|
| 1-methyl-2-thiourea | ChemIDplus |
| 1-methylthiocarbamide | ChemIDplus |
| 1-methylthiourea | ChemIDplus |
| N-methyl-2-thiourea | ChEBI |
| N-methylthiocarbamide | ChemIDplus |
| N-methylthiourea | ChemIDplus |
| Citations |
|---|