EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:188346 - pentyl dodecanoate
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCC(=O)OCCCCC |
| InChI | InChI=1S/C17H34O2/c1-3-5-7-8-9-10-11-12-13-15-17(18)19-16-14-6-4-2/h3-16H2,1-2H3 |
| InChIKey | PQWBDPUBNMEITD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anaulaciulus (ncbitaxon:1008834) | - | DOI (10.1007/s10886-012-0063-4) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentyl dodecanoate (CHEBI:188346) has functional parent pentan-1-ol (CHEBI:44884) |
| pentyl dodecanoate (CHEBI:188346) has role animal metabolite (CHEBI:75767) |
| pentyl dodecanoate (CHEBI:188346) has role flavouring agent (CHEBI:35617) |
| pentyl dodecanoate (CHEBI:188346) is a dodecanoate ester (CHEBI:87659) |
| IUPAC Name |
|---|
| pentyl dodecanoate |
| Synonyms | Source |
|---|---|
| amyl laurate | ChemIDplus |
| pentyl laurate | ChemIDplus |
| lauric acid pentyl ester | ChemIDplus |
| dodecanoic acid pentyl ester | ChemIDplus |
| n-amyl laurate | ChEBI |
| lauric acid n-amyl ester | ChEBI |
| Citations |
|---|