EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H65N7O9 |
| Net Charge | 0 |
| Average Mass | 812.022 |
| Monoisotopic Mass | 811.48438 |
| SMILES | CCC(C)C1NC(=O)C(Cc2ccoc2)N(C)C(=O)C(C)N(C)C(=O)C(CC(C)C)NC(=O)C(Cc2ccoc2)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)NC1=O |
| InChI | InChI=1S/C42H65N7O9/c1-13-26(8)35-39(53)44-33(24(4)5)38(52)45-34(25(6)7)42(56)49(12)31(19-28-14-16-57-21-28)36(50)43-30(18-23(2)3)41(55)47(10)27(9)40(54)48(11)32(37(51)46-35)20-29-15-17-58-22-29/h14-17,21-27,30-35H,13,18-20H2,1-12H3,(H,43,50)(H,44,53)(H,45,52)(H,46,51) |
| InChIKey | MHYASXKHPXOUMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhizonin A (CHEBI:188316) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 18-butan-2-yl-9,21-bis(uran-3-ylmethyl)-1,3,4,10-tetramethyl-6-(2-methylpropyl)-12,15-di(propan-2-yl)-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 143417 | ChemSpider |
| HMDB0030525 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:85803-92-5 | ChemIDplus |