EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N3O6 |
| Net Charge | 0 |
| Average Mass | 497.592 |
| Monoisotopic Mass | 497.25259 |
| SMILES | COc1cc(/C=C\C(=O)NCCCNCCCCNC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C27H35N3O6/c1-35-24-18-20(6-10-22(24)31)8-12-26(33)29-16-4-3-14-28-15-5-17-30-27(34)13-9-21-7-11-23(32)25(19-21)36-2/h6-13,18-19,28,31-32H,3-5,14-17H2,1-2H3,(H,29,33)(H,30,34)/b12-8+,13-9- |
| InChIKey | IGHVUFYLAJSILE-UQXQTEIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N10-Diferuloylspermidine (CHEBI:188297) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[4-[3-[[(Z)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]propylamino]butyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 30777009 | ChemSpider |
| HMDB0033471 | HMDB |