EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | O=C(O)CCCCCCCCCC1CC2C1C1C3C4CCC4C3C21 |
| InChI | InChI=1S/C22H34O2/c23-17(24)9-7-5-3-1-2-4-6-8-13-12-16-18(13)22-20-15-11-10-14(15)19(20)21(16)22/h13-16,18-22H,1-12H2,(H,23,24) |
| InChIKey | LXZYGXNGSMYQAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-[5]-ladderane-decanoic acid (CHEBI:188223) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 10-(4-pentacyclo[6.4.0.02,7.03,6.09,12]dodecanyl)decanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24822046 | ChemSpider |
| LMFA01140013 | LIPID MAPS |