EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O2 |
| Net Charge | 0 |
| Average Mass | 308.381 |
| Monoisotopic Mass | 308.15248 |
| SMILES | COc1ccc(/C=C2\CCCN=C2c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-22-17-8-7-14(18(12-17)23-2)11-15-5-4-10-21-19(15)16-6-3-9-20-13-16/h3,6-9,11-13H,4-5,10H2,1-2H3/b15-11+ |
| InChIKey | RPYWXZCFYPVCNQ-RVDMUPIBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DMXB-A (CHEBI:188219) has role anti-obesity agent (CHEBI:74518) |
| DMXB-A (CHEBI:188219) has role antipsychotic agent (CHEBI:35476) |
| DMXB-A (CHEBI:188219) is a dimethoxybenzene (CHEBI:51681) |
| IUPAC Name |
|---|
| 3-[(5E)-5-[(2,4-dimethoxyphenyl)methylidene]-3,4-dihydro-2H-pyridin-6-yl]pyridine |
| Synonyms | Source |
|---|---|
| 3-(2,4-dimethoxybenzylidene)anabaseine | ChEMBL |
| Dimethoxybenzylidene anabaseine | ChEMBL |
| Dmxb-a | ChEMBL |
| gts-21 | ChEMBL |
| Gts-21 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:148372-04-7 | ChemIDplus |
| Citations |
|---|