EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O4 |
| Net Charge | 0 |
| Average Mass | 372.590 |
| Monoisotopic Mass | 372.32396 |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O4/c1-2-3-4-5-11-14-17-20(23)21(24)18-15-12-9-7-6-8-10-13-16-19-22(25)26/h20-21,23-24H,2-19H2,1H3,(H,25,26) |
| InChIKey | KXWWULNBUIUDOT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydroxy-docosanoic acid (CHEBI:188210) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| 13,14-dihydroxydocosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 92526 | ChemSpider |
| LMFA01050211 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:616-01-3 | ChemIDplus |