EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O3 |
| Net Charge | 0 |
| Average Mass | 312.369 |
| Monoisotopic Mass | 312.14739 |
| SMILES | CC(C)[C@H](C(=O)Nc1ccc(C(=O)NO)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-12(2)16(13-6-4-3-5-7-13)18(22)19-15-10-8-14(9-11-15)17(21)20-23/h3-12,16,23H,1-2H3,(H,19,22)(H,20,21)/t16-/m0/s1 |
| InChIKey | LAMIXXKAWNLXOC-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AR-42 (CHEBI:188197) has role angiogenesis inhibitor (CHEBI:48422) |
| AR-42 (CHEBI:188197) has role antineoplastic agent (CHEBI:35610) |
| AR-42 (CHEBI:188197) has role apoptosis inducer (CHEBI:68495) |
| AR-42 (CHEBI:188197) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| AR-42 (CHEBI:188197) is a benzenes (CHEBI:22712) |
| AR-42 (CHEBI:188197) is a hydroxamic acid (CHEBI:24650) |
| AR-42 (CHEBI:188197) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-hydroxy-4-{[(2S)-3-methyl-2-phenylbutanoyl]amino}benzamide |
| Synonyms | Source |
|---|---|
| AR 42 | DrugBank |
| AR42 | DrugBank |
| N-hydroxy-4-[[(2S)-3-methyl-2-phenylbutanoyl]amino]benzamide | SUBMITTER |
| HDAC-42 | ChEBI |
| (S)-HDAC 42 | DrugBank |
| (S)-HDAC-42 | ChEBI |
| Citations |
|---|