EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O2 |
| Net Charge | 0 |
| Average Mass | 126.155 |
| Monoisotopic Mass | 126.06808 |
| SMILES | CCCC#CCC(=O)O |
| InChI | InChI=1S/C7H10O2/c1-2-3-4-5-6-7(8)9/h2-3,6H2,1H3,(H,8,9) |
| InChIKey | CVEHSFVOOYBVIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-heptynoic acid (CHEBI:188196) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| hept-3-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472052 | ChemSpider |
| LMFA01030488 | LIPID MAPS |