EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | O=C(O)CCCCCC1CC2C1C1C3C4CCC4C3C21 |
| InChI | InChI=1S/C18H26O2/c19-13(20)5-3-1-2-4-9-8-12-14(9)18-16-11-7-6-10(11)15(16)17(12)18/h9-12,14-18H,1-8H2,(H,19,20) |
| InChIKey | FWADMOZVPHIBNO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[5]-ladderane-hexanoic acid (CHEBI:188190) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 6-(4-pentacyclo[6.4.0.02,7.03,6.09,12]dodecanyl)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8509032 | ChemSpider |
| LMFA01140003 | LIPID MAPS |