EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCCC1OC1C/C=C\C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h4-5,8,11,16-17H,2-3,6-7,9-10,12-15H2,1H3,(H,19,20)/b5-4-,11-8- |
| InChIKey | TVHXKPMFCYEQTM-YMVJEYMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma- 12(13)-EpODE (CHEBI:188182) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (6Z,9Z)-11-(3-pentyloxiran-2-yl)undeca-6,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17220748 | ChemSpider |
| HMDB0062288 | HMDB |
| LMFA02000044 | LIPID MAPS |