EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:188172 - 3,13,19-trimethyltricosanoic acid
| Formula | C26H52O2 |
| Net Charge | 0 |
| Average Mass | 396.700 |
| Monoisotopic Mass | 396.39673 |
| SMILES | CCCCC(C)CCCCCC(C)CCCCCCCCCC(C)CC(=O)O |
| InChI | InChI=1S/C26H52O2/c1-5-6-17-23(2)19-15-12-16-20-24(3)18-13-10-8-7-9-11-14-21-25(4)22-26(27)28/h23-25H,5-22H2,1-4H3,(H,27,28) |
| InChIKey | GDZJBTPONREEGO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) | |
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (765548) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) has functional parent tricosanoic acid (CHEBI:42394) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) has role Aspergillus metabolite (CHEBI:76956) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) has role human metabolite (CHEBI:77746) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) is a fatty acid 26:0 (CHEBI:191874) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) is a methyl-branched fatty acid (CHEBI:62499) |
| 3,13,19-trimethyltricosanoic acid (CHEBI:188172) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| 3,13,19-trimethyltricosanoic acid |
| Synonyms | Source |
|---|---|
| 3,13,19-trimethyl-tricosanoic acid | LIPID MAPS |
| phthioic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 4445733 | ChemSpider |
| LMFA01020022 | LIPID MAPS |
| Citations |
|---|