EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25N4O3S |
| Net Charge | +1 |
| Average Mass | 317.435 |
| Monoisotopic Mass | 317.16419 |
| SMILES | CC(C)(C)[NH2+]C[C@H](O)COc1nsnc1N1CCOCC1 |
| InChI | InChI=1S/C13H24N4O3S/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17/h10,14,18H,4-9H2,1-3H3/p+1/t10-/m0/s1 |
| InChIKey | BLJRIMJGRPQVNF-JTQLQIEISA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-timolol(1+) (CHEBI:188157) is a ammonium ion derivative (CHEBI:35274) |
| (S)-timolol(1+) (CHEBI:188157) is conjugate acid of (S)-timolol (anhydrous) (CHEBI:9599) |
| Incoming Relation(s) |
| (S)-timolol (anhydrous) (CHEBI:9599) is conjugate base of (S)-timolol(1+) (CHEBI:188157) |
| UniProt Name | Source |
|---|---|
| (S)-timolol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| TIM | PDBeChem |