EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19ClN2O4 |
| Net Charge | 0 |
| Average Mass | 350.802 |
| Monoisotopic Mass | 350.10333 |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(CCNC2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H19ClN2O4/c1-16(2,3)24-13(21)9-20-12-5-4-10(18)8-11(12)17(15(20)23)6-7-19-14(17)22/h4-5,8H,6-7,9H2,1-3H3,(H,19,22) |
| InChIKey | FXDFCQKNBUKFLH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CAY10648 (CHEBI:188083) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,3'-pyrrolidine]-1-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 26458070 | ChemSpider |