EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19FN4O2 |
| Net Charge | 0 |
| Average Mass | 294.330 |
| Monoisotopic Mass | 294.14920 |
| SMILES | NC(=O)[C@H](CCC/N=C(/N)CF)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19FN4O2/c15-9-12(16)18-8-4-7-11(13(17)20)19-14(21)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,16,18)(H2,17,20)(H,19,21)/t11-/m0/s1 |
| InChIKey | OLFDULIIJWCYCK-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F-Amidine (CHEBI:188065) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-[(2S)-1-amino-5-[(1-amino-2-luoroethylidene)amino]-1-oxopentan-2-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 9764347 | ChemSpider |