EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O3 |
| Net Charge | 0 |
| Average Mass | 338.407 |
| Monoisotopic Mass | 338.16304 |
| SMILES | NC(=O)c1cccc(-c2cccc(OC(=O)NC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C20H22N2O3/c21-19(23)16-8-4-6-14(12-16)15-7-5-11-18(13-15)25-20(24)22-17-9-2-1-3-10-17/h4-8,11-13,17H,1-3,9-10H2,(H2,21,23)(H,22,24) |
| InChIKey | ROFVXGGUISEHAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| URB597 (CHEBI:188061) has role antipsychotic agent (CHEBI:35476) |
| URB597 (CHEBI:188061) is a biphenyls (CHEBI:22888) |
| IUPAC Name |
|---|
| [3-(3-carbamoylphenyl)phenyl] N-cyclohexylcarbamate |
| Synonyms | Source |
|---|---|
| KDS-4103 | ChEMBL |
| ORG-231295 | ChEMBL |
| urb-597 | ChEMBL |
| Urb-597 | ChEMBL |
| Urb597 | ChEMBL |
| URB 597 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1156960 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:546141-08-6 | ChemIDplus |
| Citations |
|---|