EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23NO6 |
| Net Charge | 0 |
| Average Mass | 409.438 |
| Monoisotopic Mass | 409.15254 |
| SMILES | [H][C@@]12c3cc4c(cc3C[C@H](OC(C)=O)[C@]1(C)c1ccc3c(c1CN2C)OCO3)OCO4 |
| InChI | InChI=1S/C23H23NO6/c1-12(25)30-20-7-13-6-18-19(28-10-27-18)8-14(13)22-23(20,2)16-4-5-17-21(29-11-26-17)15(16)9-24(22)3/h4-6,8,20,22H,7,9-11H2,1-3H3/t20-,22+,23-/m0/s1 |
| InChIKey | PUHCFWFODBLSAP-WWNPGLIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acetylcorynoline (CHEBI:188060) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| [(1R,12S,13R)-13,24-dimethyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaen-12-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 154160 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:18797-80-3 | ChemIDplus |