EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O3 |
| Net Charge | 0 |
| Average Mass | 284.440 |
| Monoisotopic Mass | 284.23514 |
| SMILES | CCCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C17H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(18)15-17(19)20/h2-15H2,1H3,(H,19,20) |
| InChIKey | YJFOWGUVQLQGRL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxo-heptadecanoic acid (CHEBI:188037) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 3-oxoheptadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472327 | ChemSpider |
| LMFA01060109 | LIPID MAPS |