EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H46O2 |
| Net Charge | 0 |
| Average Mass | 378.641 |
| Monoisotopic Mass | 378.34978 |
| SMILES | CC(C)CCCCCCCCCCCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C25H46O2/c1-24(2)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25(26)27/h7,9,15,17,24H,3-6,8,10-14,16,18-23H2,1-2H3,(H,26,27)/b9-7-,17-15- |
| InChIKey | IFDKMNCNGRJPIB-UNNWTIKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23-methyl-5Z,9Z-tetracosadienoic acid (CHEBI:188023) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5Z,9Z)-23-methyltetracosa-5,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020233 | LIPID MAPS |
| 4471750 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:140245-76-7 | ChemIDplus |