EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | CCCCCC/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h7-8,10-11,13-14,16-17H,2-6,9,12,15,18-19H2,1H3,(H,21,22)/b8-7+,11-10+,14-13+,17-16+ |
| InChIKey | YNVYKJQCWARJFA-SHDWVJIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7,10,13-Eicosatetraenoic acid (CHEBI:188008) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4E,7E,10E,13E)-icosa-4,7,10,13-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4471963 | ChemSpider |
| LMFA01030389 | LIPID MAPS |