EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O5 |
| Net Charge | 0 |
| Average Mass | 408.579 |
| Monoisotopic Mass | 408.28757 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](CO)CCC(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C24H40O5/c1-23-9-7-16(26)11-15(23)12-20(27)22-18-5-4-17(14(13-25)3-6-21(28)29)24(18,2)10-8-19(22)23/h14-20,22,25-27H,3-13H2,1-2H3,(H,28,29)/t14-,15-,16+,17+,18-,19-,20-,22-,23-,24+/m0/s1 |
| InChIKey | TWCXLQXSLBRURL-ASYSNUCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,7beta,21chi-Trihydroxy-5beta-cholan-24-oic Acid (CHEBI:187989) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-hydroxypentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447090 | ChemSpider |
| LMST04010248 | LIPID MAPS |