EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50O2 |
| Net Charge | 0 |
| Average Mass | 430.717 |
| Monoisotopic Mass | 430.38108 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)C[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H50O2/c1-7-20(18(2)3)16-27(31)19(4)24-10-11-25-23-9-8-21-17-22(30)12-14-28(21,5)26(23)13-15-29(24,25)6/h8,18-20,22-27,30-31H,7,9-17H2,1-6H3/t19-,20+,22-,23-,24+,25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | YCZQDKIUGZGCAN-REJZWNMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22S)-hydroxysitosterol (CHEBI:187980) has parent hydride stigmastane (CHEBI:26773) |
| (22S)-hydroxysitosterol (CHEBI:187980) has role plant metabolite (CHEBI:76924) |
| (22S)-hydroxysitosterol (CHEBI:187980) is a (22S)-22-hydroxy C29-steroid (CHEBI:188924) |
| (22S)-hydroxysitosterol (CHEBI:187980) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| (22S)-hydroxysitosterol (CHEBI:187980) is a 3β-sterol (CHEBI:35348) |
| (22S)-hydroxysitosterol (CHEBI:187980) is a phytosterols (CHEBI:26125) |
| (22S)-hydroxysitosterol (CHEBI:187980) is a stigmastane sterol (CHEBI:131703) |
| IUPAC Name |
|---|
| (22S)-stigmast-5-ene-3β,22-diol |
| Synonyms | Source |
|---|---|
| (1R,3aS,3bS,7S,9aR,9bS,11aS)-1-[(2S,3S,5R)-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol | ChEBI |
| 22S-hydroxysitosterol | LIPID MAPS |
| 22-OH-sitosterol | MetaCyc |
| stigmast-5-en-3β,22S-diol | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| (22S)-22-hydroxysitosterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 58837730 | ChemSpider |
| CPD-7190 | MetaCyc |
| LMST01040195 | LIPID MAPS |
| Citations |
|---|