EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O2 |
| Net Charge | 0 |
| Average Mass | 334.544 |
| Monoisotopic Mass | 334.28718 |
| SMILES | CCCCCC/C=C\CCCC/C=C\CCCC/C=C\CC(=O)O |
| InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h7-8,13-14,19-20H,2-6,9-12,15-18,21H2,1H3,(H,23,24)/b8-7-,14-13-,20-19- |
| InChIKey | YRJWZKBYRFAIBR-GFEMGRSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3Z,9Z,15Z-docosatrienoic acid (CHEBI:187955) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (3Z,9Z,15Z)-docosa-3,9,15-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4471983 | ChemSpider |
| LMFA01030409 | LIPID MAPS |