EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | C=C(CC/C=C/C=C/CC(C)C)C[C@@H](C)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C20H32O2/c1-16(2)11-9-7-6-8-10-12-17(3)13-18(4)14-19(5)15-20(21)22/h6-9,15-16,18H,3,10-14H2,1-2,4-5H3,(H,21,22)/b8-6+,9-7+,19-15+/t18-/m1/s1 |
| InChIKey | XQIKRXUJLGQAKM-DNIQSHCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16:3(2E,10E,12E)(3Me,5Me[R],7My,15Me) (CHEBI:187946) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,5R,10E,12E)-3,5,15-trimethyl-7-methylidenehexadeca-2,10,12-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369091 | ChemSpider |
| LMFA01020367 | LIPID MAPS |