EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O4 |
| Net Charge | 0 |
| Average Mass | 436.677 |
| Monoisotopic Mass | 436.35526 |
| SMILES | [H][C@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(O)C(C)C)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O4/c1-15(2)22(29)9-6-16(3)19-7-8-20-25-21(14-24(31)27(19,20)5)26(4)11-10-18(28)12-17(26)13-23(25)30/h15-25,28-31H,6-14H2,1-5H3/t16-,17-,18-,19-,20+,21+,22?,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | DOMPIYLJQFTRGI-GVJOOTOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Cholestane-3alpha,7alpha,12alpha,24-tetrol (CHEBI:187943) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| Manual Xrefs | Databases |
|---|---|
| LMST04030013 | LIPID MAPS |
| 4447280 | ChemSpider |